C16H22O4 — CID 163085962
3-formyl-3-hydroxy-10,11,11-trimethyltricyclo[5.3.1.01,5]undec-4-ene-4-carboxylic acid (PubChem CID 163085962) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-formyl-3-hydroxy-10,11,11-trimethyltricyclo[5.3.1.01,5]undec-4-ene-4-carboxylic acid.
| Compound Name | 3-formyl-3-hydroxy-10,11,11-trimethyltricyclo[5.3.1.01,5]undec-4-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 163085962 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-formyl-3-hydroxy-10,11,11-trimethyltricyclo[5.3.1.01,5]undec-4-ene-4-carboxylic acid |
| SMILES | CC1CCC2CC3=C(C(=O)O)C(O)(C=O)CC31C2(C)C |
| InChI | InChI=1S/C16H22O4/c1-9-4-5-10-6-11-12(13(18)19)15(20,8-17)7-16(9,11)14(10,2)3/h8-10,20H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | BGXFOVUAANXDIS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|