C35H47N3O4 — CID 163085965
1-(2,4a,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-6-yl)-5-[3-[3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]pentane-1,3-diol (PubChem CID 163085965) has the molecular formula C35H47N3O4 and a molecular weight of 573.78 g/mol. Its IUPAC name is 1-(2,4a,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-6-yl)-5-[3-[3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]pentane-1,3-diol.
| Compound Name | 1-(2,4a,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-6-yl)-5-[3-[3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]pentane-1,3-diol |
|---|---|
| PubChem CID | 163085965 |
| Molecular Formula | C35H47N3O4 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | 1-(2,4a,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-6-yl)-5-[3-[3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]pentane-1,3-diol |
| SMILES | Nc1cc(C(CCOc2cc(CCC(O)CC(O)C3CCCC4CCC=CC4C3)ccc2O)Cc2ccc[nH]2)ccn1 |
| InChI | InChI=1S/C35H47N3O4/c36-35-22-27(14-17-38-35)28(21-30-9-4-16-37-30)15-18-42-34-19-24(11-13-32(34)40)10-12-31(39)23-33(41)29-8-3-7-25-5-1-2-6-26(25)20-29/h2,4,6,9,11,13-14,16-17,19,22,25-26,28-29,31,33,37,39-41H,1,3,5,7-8,10,12,15,18,20-21,23H2,(H2,36,38) |
| InChIKey | ZKMVLSXOOBAJFC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|