C20H22N4O2 — CID 163086005
2-methyl-N-[6-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-3-pyridinyl]prop-2-enamide (PubChem CID 163086005) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-methyl-N-[6-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-3-pyridinyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[6-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 163086005 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-methyl-N-[6-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-3-pyridinyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(N2C[C@@H]3C[C@@H](C2)c2cccc(=O)n2C3)nc1 |
| InChI | InChI=1S/C20H22N4O2/c1-13(2)20(26)22-16-6-7-18(21-9-16)23-10-14-8-15(12-23)17-4-3-5-19(25)24(17)11-14/h3-7,9,14-15H,1,8,10-12H2,2H3,(H,22,26)/t14-,15-/m0/s1 |
| InChIKey | HANVSQFUKNDXRD-GJZGRUSLSA-N |
| XLogP | 2.38 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|