C81H98N2O11 — CID 163086009
CID 163086009 (PubChem CID 163086009) has the molecular formula C81H98N2O11 and a molecular weight of 1275.68 g/mol.
| Compound Name | CID 163086009 |
|---|---|
| PubChem CID | 163086009 |
| Molecular Formula | C81H98N2O11 |
| Molecular Weight | 1275.68 g/mol |
| Exact Mass | 1274.72 |
| IUPAC Name | — |
| SMILES | C[C@@H]1[C@H]2CCC[C@H]2C=C[C@]12CCC[C@]13OC45C(=C[C@@H]21)C[C@H]1CC2(CCCC2)C[C@]12C[C@@H]1C[C@]6(C)[C@]78O[C@@H]7C(=O)O[C@]6(c6ccoc6C[C@@H]([C@H]6CC[C@H]7[C@H](C=CN9CNC[C@@H]79)C6)[C@H](O)CO)CC#C[C@@H]6CC[C@@H](Cc7ccccc7)C[C@@H]6[C@]86[C@H](O)C(=O)[C@H]3[C@@]4(COC(=O)[C@H]52)[C@@H]16 |
| InChI | InChI=1S/C81H98N2O11/c1-45-55-15-8-13-48(55)20-28-74(45)25-10-26-77-63(74)35-53-34-54-39-73(23-6-7-24-73)42-75(54)38-52-37-72(2)78(58-22-30-90-62(58)36-57(61(85)41-84)50-18-19-56-51(33-50)21-29-83-44-82-40-60(56)83)27-9-14-49-17-16-47(31-46-11-4-3-5-12-46)32-59(49)79(81(72)69(92-81)71(89)93-78)65(52)76(66(77)64(86)68(79)87)43-91-70(88)67(75)80(53,76)94-77/h3-5,11-12,20-22,28-30,35,45,47-52,54-57,59-61,63,65-69,82,84-85,87H,6-8,10,13,15-19,23-27,31-34,36-44H2,1-2H3/t45-,47+,48+,49-,50+,51-,52+,54+,55-,56+,57+,59+,60+,61-,63+,65-,66+,67+,68-,69-,72+,74-,75-,76-,77+,78+,79+,80?,81-/m1/s1 |
| InChIKey | XHUAWNBIWJRTMX-JUNPHWHLSA-N |
| XLogP | 11.12 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 94 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1275.68 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|