C20H34O3 — CID 163086227
(1R,2E,5R,6E,8S,11S,12S)-1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-2,6-diene-5,12-diol (PubChem CID 163086227) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1R,2E,5R,6E,8S,11S,12S)-1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-2,6-diene-5,12-diol.
| Compound Name | (1R,2E,5R,6E,8S,11S,12S)-1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-2,6-diene-5,12-diol |
|---|---|
| PubChem CID | 163086227 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1R,2E,5R,6E,8S,11S,12S)-1,5,11-trimethyl-8-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-2,6-diene-5,12-diol |
| SMILES | CC(C)[C@H]1/C=C/[C@](C)(O)C/C=C\[C@@]2(C)CC[C@H](O)[C@](C)(CC1)O2 |
| InChI | InChI=1S/C20H34O3/c1-15(2)16-7-12-18(3,22)10-6-11-19(4)13-9-17(21)20(5,23-19)14-8-16/h6-7,11-12,15-17,21-22H,8-10,13-14H2,1-5H3/b11-6-,12-7+/t16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | NCJHATPLORRZDC-DDWSPJHCSA-N |
| XLogP | 3.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|