About N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide
N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide (PubChem CID 163087352) has the molecular formula C17H28N2O4
and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide.
Molecular Properties
| Compound Name | N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide |
| PubChem CID | 163087352 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide |
| SMILES | CCC(=O)NCC1OC(Cc2cc(C(C)(C)C)on2)CCC1O |
| InChI | InChI=1S/C17H28N2O4/c1-5-16(21)18-10-14-13(20)7-6-12(22-14)8-11-9-15(23-19-11)17(2,3)4/h9,12-14,20H,5-8,10H2,1-4H3,(H,18,21) |
| InChIKey | BBZFHMKSMOAVOB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide?
The IUPAC name of N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide (CID 163087352) is N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide.
What is the SMILES notation for N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide?
The canonical SMILES for N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide is CCC(=O)NCC1OC(Cc2cc(C(C)(C)C)on2)CCC1O.
What is the InChIKey of N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide?
The InChIKey is BBZFHMKSMOAVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O4/c1-5-16(21)18-10-14-13(20)7-6-12(22-14)8-11-9-15(23-19-11)17(2,3)4/h9,12-14,20H,5-8,10H2,1-4H3,(H,18,21).
What are the key properties of N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide?
N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide has a molecular weight of 324.42 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-[(5-tert-butyl-1,2-oxazol-3-yl)methyl]-3-hydroxyoxan-2-yl]methyl]propanamide is sourced from PubChem (CID 163087352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).