C16H16O3 — CID 163087677
3-methyl-11-(3-methylbut-2-enyl)-2,9-dioxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7-tetraen-10-one (PubChem CID 163087677) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-methyl-11-(3-methylbut-2-enyl)-2,9-dioxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7-tetraen-10-one.
| Compound Name | 3-methyl-11-(3-methylbut-2-enyl)-2,9-dioxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7-tetraen-10-one |
|---|---|
| PubChem CID | 163087677 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-methyl-11-(3-methylbut-2-enyl)-2,9-dioxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7-tetraen-10-one |
| SMILES | CC(C)=CCc1c2c3c(cccc3oc1=O)C(C)O2 |
| InChI | InChI=1S/C16H16O3/c1-9(2)7-8-12-15-14-11(10(3)18-15)5-4-6-13(14)19-16(12)17/h4-7,10H,8H2,1-3H3 |
| InChIKey | KNOLKYCXGJSPOK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|