C34H36N4O6 — CID 163088230
N-[1,2,3-trimethoxy-9-oxo-10-[[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 163088230) has the molecular formula C34H36N4O6 and a molecular weight of 596.68 g/mol. Its IUPAC name is N-[1,2,3-trimethoxy-9-oxo-10-[[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | N-[1,2,3-trimethoxy-9-oxo-10-[[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 163088230 |
| Molecular Formula | C34H36N4O6 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | N-[1,2,3-trimethoxy-9-oxo-10-[[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCC(=O)N3CCc4[nH]c5ccccc5c4C3)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C34H36N4O6/c1-19(39)36-26-11-9-20-15-30(42-2)33(43-3)34(44-4)32(20)22-10-12-28(29(40)16-23(22)26)35-17-31(41)38-14-13-27-24(18-38)21-7-5-6-8-25(21)37-27/h5-8,10,12,15-16,26,37H,9,11,13-14,17-18H2,1-4H3,(H,35,40)(H,36,39) |
| InChIKey | TWXVWPZKTBPRIX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|