C21H31N5O2S — CID 163088247
4-[5-oxo-5-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 163088247) has the molecular formula C21H31N5O2S and a molecular weight of 417.58 g/mol. Its IUPAC name is 4-[5-oxo-5-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 4-[5-oxo-5-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 163088247 |
| Molecular Formula | C21H31N5O2S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-[5-oxo-5-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | O=C1NC2CSC(CCCCC(=O)N3CCN(CCc4ccncc4)CC3)C2N1 |
| InChI | InChI=1S/C21H31N5O2S/c27-19(4-2-1-3-18-20-17(15-29-18)23-21(28)24-20)26-13-11-25(12-14-26)10-7-16-5-8-22-9-6-16/h5-6,8-9,17-18,20H,1-4,7,10-15H2,(H2,23,24,28) |
| InChIKey | ZAMCTNDEWQPNKS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|