C37H48N4O4 — CID 163088427
1-(3,4,5,5a,6,7,8,9,10,10a-decahydrocyclohepta[e]indol-9-yl)-5-[3-[3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]pentane-1,3-diol (PubChem CID 163088427) has the molecular formula C37H48N4O4 and a molecular weight of 612.82 g/mol. Its IUPAC name is 1-(3,4,5,5a,6,7,8,9,10,10a-decahydrocyclohepta[e]indol-9-yl)-5-[3-[3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]pentane-1,3-diol.
| Compound Name | 1-(3,4,5,5a,6,7,8,9,10,10a-decahydrocyclohepta[e]indol-9-yl)-5-[3-[3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]pentane-1,3-diol |
|---|---|
| PubChem CID | 163088427 |
| Molecular Formula | C37H48N4O4 |
| Molecular Weight | 612.82 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | 1-(3,4,5,5a,6,7,8,9,10,10a-decahydrocyclohepta[e]indol-9-yl)-5-[3-[3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]pentane-1,3-diol |
| SMILES | Nc1cc(C(CCOc2cc(CCC(O)CC(O)C3CCCC4CCc5[nH]ccc5C4C3)ccc2O)Cc2ccc[nH]2)ccn1 |
| InChI | InChI=1S/C37H48N4O4/c38-37-22-26(12-16-41-37)27(20-29-5-2-15-39-29)14-18-45-36-19-24(7-11-34(36)43)6-9-30(42)23-35(44)28-4-1-3-25-8-10-33-31(13-17-40-33)32(25)21-28/h2,5,7,11-13,15-17,19,22,25,27-28,30,32,35,39-40,42-44H,1,3-4,6,8-10,14,18,20-21,23H2,(H2,38,41) |
| InChIKey | IWYFKWHJEIEAMN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 140.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.82 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |