C20H17NO5 — CID 163089169
13-methyl-5,7,19,21-tetraoxa-13-azahexacyclo[12.10.0.02,10.04,8.015,23.018,22]tetracosa-2,4(8),9,15(23),16,18(22)-hexaen-24-one (PubChem CID 163089169) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 13-methyl-5,7,19,21-tetraoxa-13-azahexacyclo[12.10.0.02,10.04,8.015,23.018,22]tetracosa-2,4(8),9,15(23),16,18(22)-hexaen-24-one.
| Compound Name | 13-methyl-5,7,19,21-tetraoxa-13-azahexacyclo[12.10.0.02,10.04,8.015,23.018,22]tetracosa-2,4(8),9,15(23),16,18(22)-hexaen-24-one |
|---|---|
| PubChem CID | 163089169 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 13-methyl-5,7,19,21-tetraoxa-13-azahexacyclo[12.10.0.02,10.04,8.015,23.018,22]tetracosa-2,4(8),9,15(23),16,18(22)-hexaen-24-one |
| SMILES | CN1CCc2cc3c(cc2C2C(=O)c4c(ccc5c4OCO5)C21)OCO3 |
| InChI | InChI=1S/C20H17NO5/c1-21-5-4-10-6-14-15(25-8-24-14)7-12(10)16-18(21)11-2-3-13-20(26-9-23-13)17(11)19(16)22/h2-3,6-7,16,18H,4-5,8-9H2,1H3 |
| InChIKey | ZNMBKYFBDJDSHG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |