About 1,2-dichloronaphthalene
1,2-dichloronaphthalene (PubChem CID 16309) has the molecular formula C10H6Cl2
and a molecular weight of 197.06 g/mol. Its IUPAC name is 1,2-dichloronaphthalene.
Molecular Properties
| Compound Name | 1,2-dichloronaphthalene |
| PubChem CID | 16309 |
| Molecular Formula | C10H6Cl2 |
| Molecular Weight | 197.06 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | 1,2-dichloronaphthalene |
| SMILES | Clc1ccc2ccccc2c1Cl |
| InChI | InChI=1S/C10H6Cl2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
| InChIKey | MOXLHAPKZWTHEX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.06 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dichloronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloronaphthalene?
The IUPAC name of 1,2-dichloronaphthalene (CID 16309) is 1,2-dichloronaphthalene.
What is the SMILES notation for 1,2-dichloronaphthalene?
The canonical SMILES for 1,2-dichloronaphthalene is Clc1ccc2ccccc2c1Cl.
What is the InChIKey of 1,2-dichloronaphthalene?
The InChIKey is MOXLHAPKZWTHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H.
What are the key properties of 1,2-dichloronaphthalene?
1,2-dichloronaphthalene has a molecular weight of 197.06 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloronaphthalene is sourced from PubChem (CID 16309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).