C23H25NO2 — CID 163090167
8,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.12,17.05,20.06,11.014,19]henicosa-1,3,5(20),6(11),7,9-hexaen-9-ol (PubChem CID 163090167) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 8,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.12,17.05,20.06,11.014,19]henicosa-1,3,5(20),6(11),7,9-hexaen-9-ol.
| Compound Name | 8,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.12,17.05,20.06,11.014,19]henicosa-1,3,5(20),6(11),7,9-hexaen-9-ol |
|---|---|
| PubChem CID | 163090167 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 8,13,13,17-tetramethyl-21-oxa-12-azahexacyclo[10.7.1.12,17.05,20.06,11.014,19]henicosa-1,3,5(20),6(11),7,9-hexaen-9-ol |
| SMILES | Cc1cc2c3ccc4c5c3n(c2cc1O)C(C)(C)C1CCC(C)(CC51)O4 |
| InChI | InChI=1S/C23H25NO2/c1-12-9-14-13-5-6-19-20-15-11-23(4,26-19)8-7-16(15)22(2,3)24(21(13)20)17(14)10-18(12)25/h5-6,9-10,15-16,25H,7-8,11H2,1-4H3 |
| InChIKey | VGSGRIAAAVWVHZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |