C14H23ClO3 — CID 163090508
(1R,2S,5R,7R,8S,9R)-7-chloro-4,4,8-trimethyl-12-oxatricyclo[7.2.1.02,5]dodecane-1,8-diol (PubChem CID 163090508) has the molecular formula C14H23ClO3 and a molecular weight of 274.79 g/mol. Its IUPAC name is (1R,2S,5R,7R,8S,9R)-7-chloro-4,4,8-trimethyl-12-oxatricyclo[7.2.1.02,5]dodecane-1,8-diol.
| Compound Name | (1R,2S,5R,7R,8S,9R)-7-chloro-4,4,8-trimethyl-12-oxatricyclo[7.2.1.02,5]dodecane-1,8-diol |
|---|---|
| PubChem CID | 163090508 |
| Molecular Formula | C14H23ClO3 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (1R,2S,5R,7R,8S,9R)-7-chloro-4,4,8-trimethyl-12-oxatricyclo[7.2.1.02,5]dodecane-1,8-diol |
| SMILES | CC1(C)C[C@H]2[C@H]1C[C@@H](Cl)[C@@](C)(O)[C@H]1CC[C@@]2(O)O1 |
| InChI | InChI=1S/C14H23ClO3/c1-12(2)7-9-8(12)6-10(15)13(3,16)11-4-5-14(9,17)18-11/h8-11,16-17H,4-7H2,1-3H3/t8-,9+,10-,11-,13-,14-/m1/s1 |
| InChIKey | SVAWAPQDXAOEIY-AYDPQTPUSA-N |
| XLogP | 2.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|