C13H12O3 — CID 163090523
(7R)-3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),9-tetraen-11-one (PubChem CID 163090523) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (7R)-3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),9-tetraen-11-one.
| Compound Name | (7R)-3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),9-tetraen-11-one |
|---|---|
| PubChem CID | 163090523 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (7R)-3,7-dimethyl-2,6-dioxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),9-tetraen-11-one |
| SMILES | Cc1cc2c3c(cc(=O)cc-3o1)C[C@@H](C)O2 |
| InChI | InChI=1S/C13H12O3/c1-7-3-9-5-10(14)6-12-13(9)11(15-7)4-8(2)16-12/h4-7H,3H2,1-2H3/t7-/m1/s1 |
| InChIKey | FSDVTWRZVXYMTO-SSDOTTSWSA-N |
| XLogP | 2.38 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |