C16H25NS — CID 163090601
(1R,4R,4aS,6S)-6-isothiocyanato-1,6-dimethyl-4-propan-2-yl-2,3,4,4a,5,7-hexahydro-1H-naphthalene (PubChem CID 163090601) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is (1R,4R,4aS,6S)-6-isothiocyanato-1,6-dimethyl-4-propan-2-yl-2,3,4,4a,5,7-hexahydro-1H-naphthalene.
| Compound Name | (1R,4R,4aS,6S)-6-isothiocyanato-1,6-dimethyl-4-propan-2-yl-2,3,4,4a,5,7-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 163090601 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (1R,4R,4aS,6S)-6-isothiocyanato-1,6-dimethyl-4-propan-2-yl-2,3,4,4a,5,7-hexahydro-1H-naphthalene |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C2=CC[C@](C)(N=C=S)C[C@H]21 |
| InChI | InChI=1S/C16H25NS/c1-11(2)13-6-5-12(3)14-7-8-16(4,17-10-18)9-15(13)14/h7,11-13,15H,5-6,8-9H2,1-4H3/t12-,13-,15+,16+/m1/s1 |
| InChIKey | KDOKXEAZIZAWIZ-VDERGJSUSA-N |
| XLogP | 4.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|