C26H30O13 — CID 163090965
methyl 5-hydroxy-7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 163090965) has the molecular formula C26H30O13 and a molecular weight of 550.51 g/mol. Its IUPAC name is methyl 5-hydroxy-7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 5-hydroxy-7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 163090965 |
| Molecular Formula | C26H30O13 |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | methyl 5-hydroxy-7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=COC(OC2OC(COC(=O)C=Cc3ccc(O)cc3)C(O)C(O)C2O)C2C(CO)=CC(O)C12 |
| InChI | InChI=1S/C26H30O13/c1-35-24(34)15-10-37-25(19-13(9-27)8-16(29)20(15)19)39-26-23(33)22(32)21(31)17(38-26)11-36-18(30)7-4-12-2-5-14(28)6-3-12/h2-8,10,16-17,19-23,25-29,31-33H,9,11H2,1H3 |
| InChIKey | FBVHDKRFONUDDG-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|