C23H24N6O7 — CID 163091221
N-[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]ethyl]-3-amino-1H-1,2,4-triazole-5-carboxamide (PubChem CID 163091221) has the molecular formula C23H24N6O7 and a molecular weight of 496.48 g/mol. Its IUPAC name is N-[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]ethyl]-3-amino-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]ethyl]-3-amino-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 163091221 |
| Molecular Formula | C23H24N6O7 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]ethyl]-3-amino-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCNC(=O)c3nc(N)n[nH]3)C(=O)C12C |
| InChI | InChI=1S/C23H24N6O7/c1-8-16(32)14(10(3)30)18-15(17(8)33)23(4)12(36-18)7-11(31)13(19(23)34)9(2)25-5-6-26-21(35)20-27-22(24)29-28-20/h7,25,32-33H,5-6H2,1-4H3,(H,26,35)(H3,24,27,28,29) |
| InChIKey | MAPPLUJYMIEPLE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 209.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|