C31H52O — CID 163092397
(2R,4E,8E)-2-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-5,9,14-trimethylpentadeca-4,8,13-trien-1-ol (PubChem CID 163092397) has the molecular formula C31H52O and a molecular weight of 440.76 g/mol. Its IUPAC name is (2R,4E,8E)-2-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-5,9,14-trimethylpentadeca-4,8,13-trien-1-ol.
| Compound Name | (2R,4E,8E)-2-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-5,9,14-trimethylpentadeca-4,8,13-trien-1-ol |
|---|---|
| PubChem CID | 163092397 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | (2R,4E,8E)-2-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-5,9,14-trimethylpentadeca-4,8,13-trien-1-ol |
| SMILES | C=C(CC/C=C(\C)CCC=C(C)C)[C@H](CO)C/C=C(\C)CC/C=C(\C)CCCC=C(C)C |
| InChI | InChI=1S/C31H52O/c1-25(2)14-9-10-16-27(5)18-12-19-29(7)22-23-31(24-32)30(8)21-13-20-28(6)17-11-15-26(3)4/h14-15,18,20,22,31-32H,8-13,16-17,19,21,23-24H2,1-7H3/b27-18+,28-20+,29-22+/t31-/m0/s1 |
| InChIKey | PZHZGNSCKVIFBY-UJERAUKKSA-N |
| XLogP | 9.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|