C20H24O6 — CID 163092446
8-formyl-4-methyl-13-methylidene-11-oxotetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid (PubChem CID 163092446) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 8-formyl-4-methyl-13-methylidene-11-oxotetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid.
| Compound Name | 8-formyl-4-methyl-13-methylidene-11-oxotetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 163092446 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 8-formyl-4-methyl-13-methylidene-11-oxotetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| SMILES | C=C1CC23CC1C(=O)CC2C1(C=O)CCCC(C)(C(=O)O)C1C3C(=O)O |
| InChI | InChI=1S/C20H24O6/c1-10-7-20-8-11(10)12(22)6-13(20)19(9-21)5-3-4-18(2,17(25)26)15(19)14(20)16(23)24/h9,11,13-15H,1,3-8H2,2H3,(H,23,24)(H,25,26) |
| InChIKey | SEDBAGHKXIEGAI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|