C29H52N2O9 — CID 163092515
methyl (2S)-3-hydroxy-2-[[(Z,3R)-3-[(2S)-3-hydroxy-2-[[(3S)-3-hydroxydecanoyl]amino]propanoyl]oxydodec-5-enoyl]amino]propanoate (PubChem CID 163092515) has the molecular formula C29H52N2O9 and a molecular weight of 572.74 g/mol. Its IUPAC name is methyl (2S)-3-hydroxy-2-[[(Z,3R)-3-[(2S)-3-hydroxy-2-[[(3S)-3-hydroxydecanoyl]amino]propanoyl]oxydodec-5-enoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-hydroxy-2-[[(Z,3R)-3-[(2S)-3-hydroxy-2-[[(3S)-3-hydroxydecanoyl]amino]propanoyl]oxydodec-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 163092515 |
| Molecular Formula | C29H52N2O9 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.37 |
| IUPAC Name | methyl (2S)-3-hydroxy-2-[[(Z,3R)-3-[(2S)-3-hydroxy-2-[[(3S)-3-hydroxydecanoyl]amino]propanoyl]oxydodec-5-enoyl]amino]propanoate |
| SMILES | CCCCCC/C=C\C[C@H](CC(=O)N[C@@H](CO)C(=O)OC)OC(=O)[C@H](CO)NC(=O)C[C@@H](O)CCCCCCC |
| InChI | InChI=1S/C29H52N2O9/c1-4-6-8-10-11-13-15-17-23(19-27(36)30-24(20-32)28(37)39-3)40-29(38)25(21-33)31-26(35)18-22(34)16-14-12-9-7-5-2/h13,15,22-25,32-34H,4-12,14,16-21H2,1-3H3,(H,30,36)(H,31,35)/b15-13-/t22-,23+,24-,25-/m0/s1 |
| InChIKey | HBWLJUYGOVHYKD-GWENHUIKSA-N |
| XLogP | 2.44 |
| TPSA | 171.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|