C37H60O7 — CID 163092550
[17-[5-(1,2-dihydroxy-2-methylpropyl)-2-methoxy-5-methyloxolan-3-yl]-7-hydroxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-methylbut-2-enoate (PubChem CID 163092550) has the molecular formula C37H60O7 and a molecular weight of 616.88 g/mol. Its IUPAC name is [17-[5-(1,2-dihydroxy-2-methylpropyl)-2-methoxy-5-methyloxolan-3-yl]-7-hydroxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-methylbut-2-enoate.
| Compound Name | [17-[5-(1,2-dihydroxy-2-methylpropyl)-2-methoxy-5-methyloxolan-3-yl]-7-hydroxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 163092550 |
| Molecular Formula | C37H60O7 |
| Molecular Weight | 616.88 g/mol |
| Exact Mass | 616.43 |
| IUPAC Name | [17-[5-(1,2-dihydroxy-2-methylpropyl)-2-methoxy-5-methyloxolan-3-yl]-7-hydroxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-methylbut-2-enoate |
| SMILES | COC1OC(C)(C(O)C(C)(C)O)CC1C1CC=C2C1(C)CCC1C3(C)CCC(OC(=O)C=C(C)C)C(C)(C)C3CC(O)C21C |
| InChI | InChI=1S/C37H60O7/c1-21(2)18-29(39)43-28-15-17-35(8)25-14-16-34(7)23(22-20-36(9,44-30(22)42-11)31(40)33(5,6)41)12-13-24(34)37(25,10)27(38)19-26(35)32(28,3)4/h13,18,22-23,25-28,30-31,38,40-41H,12,14-17,19-20H2,1-11H3 |
| InChIKey | ZMFONCOJLUKLEV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.88 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|