C22H28O8 — CID 163092783
4-(2-hydroxy-2,3-dimethyl-4-oxopentanoyl)oxy-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylic acid (PubChem CID 163092783) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is 4-(2-hydroxy-2,3-dimethyl-4-oxopentanoyl)oxy-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylic acid.
| Compound Name | 4-(2-hydroxy-2,3-dimethyl-4-oxopentanoyl)oxy-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylic acid |
|---|---|
| PubChem CID | 163092783 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-(2-hydroxy-2,3-dimethyl-4-oxopentanoyl)oxy-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylic acid |
| SMILES | C=C1C(=O)OC2C=C(C)CCC=C(C(=O)O)CC(OC(=O)C(C)(O)C(C)C(C)=O)C12 |
| InChI | InChI=1S/C22H28O8/c1-11-7-6-8-15(19(24)25)10-17(18-12(2)20(26)29-16(18)9-11)30-21(27)22(5,28)13(3)14(4)23/h8-9,13,16-18,28H,2,6-7,10H2,1,3-5H3,(H,24,25) |
| InChIKey | UXRDNWMNLSDJBR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|