C29H27N5O9 — CID 163093442
4-[5-[3-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-4-hydroxyphenyl]tetrazol-2-yl]butanoic acid (PubChem CID 163093442) has the molecular formula C29H27N5O9 and a molecular weight of 589.56 g/mol. Its IUPAC name is 4-[5-[3-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-4-hydroxyphenyl]tetrazol-2-yl]butanoic acid.
| Compound Name | 4-[5-[3-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-4-hydroxyphenyl]tetrazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 163093442 |
| Molecular Formula | C29H27N5O9 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | 4-[5-[3-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-4-hydroxyphenyl]tetrazol-2-yl]butanoic acid |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)Nc3cc(-c4nnn(CCCC(=O)O)n4)ccc3O)C(=O)C12C |
| InChI | InChI=1S/C29H27N5O9/c1-12-24(40)22(14(3)35)26-23(25(12)41)29(4)19(43-26)11-18(37)21(27(29)42)13(2)30-16-10-15(7-8-17(16)36)28-31-33-34(32-28)9-5-6-20(38)39/h7-8,10-11,30,36,40-41H,5-6,9H2,1-4H3,(H,38,39) |
| InChIKey | WLWWLZZEUXDCMS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 214.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|