C30H48O5 — CID 163093536
(1S,2R,4S,6S,8R,12R,13R,14R,19R)-6-[(1S)-1,2-dihydroxy-2-methylpropyl]-12-hydroxy-1,2,8,14,18,18-hexamethyl-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-9-en-17-one (PubChem CID 163093536) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is (1S,2R,4S,6S,8R,12R,13R,14R,19R)-6-[(1S)-1,2-dihydroxy-2-methylpropyl]-12-hydroxy-1,2,8,14,18,18-hexamethyl-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-9-en-17-one.
| Compound Name | (1S,2R,4S,6S,8R,12R,13R,14R,19R)-6-[(1S)-1,2-dihydroxy-2-methylpropyl]-12-hydroxy-1,2,8,14,18,18-hexamethyl-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-9-en-17-one |
|---|---|
| PubChem CID | 163093536 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | (1S,2R,4S,6S,8R,12R,13R,14R,19R)-6-[(1S)-1,2-dihydroxy-2-methylpropyl]-12-hydroxy-1,2,8,14,18,18-hexamethyl-5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-9-en-17-one |
| SMILES | C[C@@H]1C[C@@H]([C@H](O)C(C)(C)O)O[C@H]2C[C@@]3(C)C(=C12)C[C@@H](O)[C@@H]1[C@]2(C)CCC(=O)C(C)(C)[C@@H]2CC[C@@]13C |
| InChI | InChI=1S/C30H48O5/c1-16-13-19(25(33)27(4,5)34)35-20-15-30(8)17(23(16)20)14-18(31)24-28(6)11-10-22(32)26(2,3)21(28)9-12-29(24,30)7/h16,18-21,24-25,31,33-34H,9-15H2,1-8H3/t16-,18-,19+,20+,21+,24-,25+,28-,29+,30+/m1/s1 |
| InChIKey | YNKJSQIXVXWFBK-MISHMBOBSA-N |
| XLogP | 4.81 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|