C24H28O13 — CID 163093616
[2-(hydroxymethyl)-10-(3,4,5,6-tetrahydroxyoxan-2-yl)oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 163093616) has the molecular formula C24H28O13 and a molecular weight of 524.48 g/mol. Its IUPAC name is [2-(hydroxymethyl)-10-(3,4,5,6-tetrahydroxyoxan-2-yl)oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(hydroxymethyl)-10-(3,4,5,6-tetrahydroxyoxan-2-yl)oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163093616 |
| Molecular Formula | C24H28O13 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | [2-(hydroxymethyl)-10-(3,4,5,6-tetrahydroxyoxan-2-yl)oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OC2C3C=COC(OC4OC(O)C(O)C(O)C4O)C3C3(CO)OC23)ccc1O |
| InChI | InChI=1S/C24H28O13/c1-32-13-8-10(2-4-12(13)26)3-5-14(27)34-19-11-6-7-33-22(15(11)24(9-25)20(19)37-24)36-23-18(30)16(28)17(29)21(31)35-23/h2-8,11,15-23,25-26,28-31H,9H2,1H3 |
| InChIKey | GAPFSCDHSVFRFR-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 197.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|