C21H28O3 — CID 163093921
methyl (4aS,10aS)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylate (PubChem CID 163093921) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is methyl (4aS,10aS)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylate.
| Compound Name | methyl (4aS,10aS)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 163093921 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl (4aS,10aS)-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-4,9,10,10a-tetrahydro-3H-phenanthrene-2-carboxylate |
| SMILES | COC(=O)C1=C(C)[C@@H]2CCc3cc(C(C)(C)O)ccc3[C@@]2(C)CC1 |
| InChI | InChI=1S/C21H28O3/c1-13-16(19(22)24-5)10-11-21(4)17(13)8-6-14-12-15(20(2,3)23)7-9-18(14)21/h7,9,12,17,23H,6,8,10-11H2,1-5H3/t17-,21-/m0/s1 |
| InChIKey | XYNIRRMXUOEHCW-UWJYYQICSA-N |
| XLogP | 4.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |