C15H22O4 — CID 163094900
(3S,6S,8R,10S)-3-hydroxy-6-(hydroxymethyl)-2,10-dimethyltricyclo[6.3.0.03,6]undec-1-ene-10-carboxylic acid (PubChem CID 163094900) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3S,6S,8R,10S)-3-hydroxy-6-(hydroxymethyl)-2,10-dimethyltricyclo[6.3.0.03,6]undec-1-ene-10-carboxylic acid.
| Compound Name | (3S,6S,8R,10S)-3-hydroxy-6-(hydroxymethyl)-2,10-dimethyltricyclo[6.3.0.03,6]undec-1-ene-10-carboxylic acid |
|---|---|
| PubChem CID | 163094900 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3S,6S,8R,10S)-3-hydroxy-6-(hydroxymethyl)-2,10-dimethyltricyclo[6.3.0.03,6]undec-1-ene-10-carboxylic acid |
| SMILES | CC1=C2C[C@@](C)(C(=O)O)C[C@H]2C[C@]2(CO)CC[C@]12O |
| InChI | InChI=1S/C15H22O4/c1-9-11-7-13(2,12(17)18)5-10(11)6-14(8-16)3-4-15(9,14)19/h10,16,19H,3-8H2,1-2H3,(H,17,18)/t10-,13-,14-,15-/m0/s1 |
| InChIKey | XAOHJINHOQXUTQ-HJPIBITLSA-N |
| XLogP | 1.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|