C21H28N2O2 — CID 163094905
(R)-[(2R,4S,5R)-5-ethenyl-4-ethyl-1-methylpiperidin-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 163094905) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (R)-[(2R,4S,5R)-5-ethenyl-4-ethyl-1-methylpiperidin-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(2R,4S,5R)-5-ethenyl-4-ethyl-1-methylpiperidin-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 163094905 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (R)-[(2R,4S,5R)-5-ethenyl-4-ethyl-1-methylpiperidin-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@H]1CN(C)[C@@H]([C@H](O)c2ccnc3ccc(OC)cc23)C[C@@H]1CC |
| InChI | InChI=1S/C21H28N2O2/c1-5-14-11-20(23(3)13-15(14)6-2)21(24)17-9-10-22-19-8-7-16(25-4)12-18(17)19/h6-10,12,14-15,20-21,24H,2,5,11,13H2,1,3-4H3/t14-,15-,20+,21+/m0/s1 |
| InChIKey | YQIZUZNENYMJNQ-VUEDXXQZSA-N |
| XLogP | 3.81 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|