C30H42O7 — CID 163095022
(2R,3R,4aR,5S,6R,7R,8R,8aS)-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-(3-methylbut-2-enyl)-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one (PubChem CID 163095022) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is (2R,3R,4aR,5S,6R,7R,8R,8aS)-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-(3-methylbut-2-enyl)-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one.
| Compound Name | (2R,3R,4aR,5S,6R,7R,8R,8aS)-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-(3-methylbut-2-enyl)-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
|---|---|
| PubChem CID | 163095022 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | (2R,3R,4aR,5S,6R,7R,8R,8aS)-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-(3-methylbut-2-enyl)-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
| SMILES | C=C(C)[C@@H](CC=C(C)C)C[C@@H]1[C@H](O)[C@@H](CC=C(C)C)[C@H](O)[C@H]2C(=O)[C@H](O)[C@@H](c3ccc(O)cc3O)O[C@@H]12 |
| InChI | InChI=1S/C30H42O7/c1-15(2)7-9-18(17(5)6)13-22-25(33)21(11-8-16(3)4)26(34)24-27(35)28(36)30(37-29(22)24)20-12-10-19(31)14-23(20)32/h7-8,10,12,14,18,21-22,24-26,28-34,36H,5,9,11,13H2,1-4,6H3/t18-,21+,22+,24-,25+,26-,28-,29-,30+/m0/s1 |
| InChIKey | AUHQSSGZAWZOQC-QRJWZMRNSA-N |
| XLogP | 4.35 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|