C25H50N4O5 — CID 163095312
(3R,10R)-3-[[[(2S,4R)-2-amino-4-methylpiperidin-4-yl]amino]methyl]-3,10-dihydroxy-12-[(2R,5R,6S)-5-hydroxy-6-methylpiperidin-2-yl]dodecanoic acid (PubChem CID 163095312) has the molecular formula C25H50N4O5 and a molecular weight of 486.70 g/mol. Its IUPAC name is (3R,10R)-3-[[[(2S,4R)-2-amino-4-methylpiperidin-4-yl]amino]methyl]-3,10-dihydroxy-12-[(2R,5R,6S)-5-hydroxy-6-methylpiperidin-2-yl]dodecanoic acid.
| Compound Name | (3R,10R)-3-[[[(2S,4R)-2-amino-4-methylpiperidin-4-yl]amino]methyl]-3,10-dihydroxy-12-[(2R,5R,6S)-5-hydroxy-6-methylpiperidin-2-yl]dodecanoic acid |
|---|---|
| PubChem CID | 163095312 |
| Molecular Formula | C25H50N4O5 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.38 |
| IUPAC Name | (3R,10R)-3-[[[(2S,4R)-2-amino-4-methylpiperidin-4-yl]amino]methyl]-3,10-dihydroxy-12-[(2R,5R,6S)-5-hydroxy-6-methylpiperidin-2-yl]dodecanoic acid |
| SMILES | C[C@@H]1N[C@H](CC[C@H](O)CCCCCC[C@](O)(CN[C@]2(C)CCN[C@H](N)C2)CC(=O)O)CC[C@H]1O |
| InChI | InChI=1S/C25H50N4O5/c1-18-21(31)11-9-19(29-18)8-10-20(30)7-5-3-4-6-12-25(34,16-23(32)33)17-28-24(2)13-14-27-22(26)15-24/h18-22,27-31,34H,3-17,26H2,1-2H3,(H,32,33)/t18-,19+,20+,21+,22-,24+,25+/m0/s1 |
| InChIKey | KPQZSKZBZYXQBH-JPQZOJLPSA-N |
| XLogP | 1.19 |
| TPSA | 160.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|