C21H32O6 — CID 163096208
methyl (4aR,5R,6S,7R,8aR)-7-acetyloxy-5-(3-methoxy-3-oxopropyl)-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate (PubChem CID 163096208) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is methyl (4aR,5R,6S,7R,8aR)-7-acetyloxy-5-(3-methoxy-3-oxopropyl)-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (4aR,5R,6S,7R,8aR)-7-acetyloxy-5-(3-methoxy-3-oxopropyl)-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 163096208 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | methyl (4aR,5R,6S,7R,8aR)-7-acetyloxy-5-(3-methoxy-3-oxopropyl)-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)CC[C@@]1(C)[C@H](C)[C@H](OC(C)=O)C[C@@]2(C)C(C(=O)OC)=CCC[C@H]12 |
| InChI | InChI=1S/C21H32O6/c1-13-16(27-14(2)22)12-21(4)15(19(24)26-6)8-7-9-17(21)20(13,3)11-10-18(23)25-5/h8,13,16-17H,7,9-12H2,1-6H3/t13-,16-,17-,20+,21+/m1/s1 |
| InChIKey | BRPLPGDXTHMNKH-KLEFUKBASA-N |
| XLogP | 3.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|