C16H26N+ — CID 163097760
(8a-methyl-3-propan-2-yl-2,3,3a,6,7,8-hexahydro-1H-azulen-5-yl)methyl-methylidyneazanium (PubChem CID 163097760) has the molecular formula C16H26N+ and a molecular weight of 232.39 g/mol. Its IUPAC name is (8a-methyl-3-propan-2-yl-2,3,3a,6,7,8-hexahydro-1H-azulen-5-yl)methyl-methylidyneazanium.
| Compound Name | (8a-methyl-3-propan-2-yl-2,3,3a,6,7,8-hexahydro-1H-azulen-5-yl)methyl-methylidyneazanium |
|---|---|
| PubChem CID | 163097760 |
| Molecular Formula | C16H26N+ |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.21 |
| IUPAC Name | (8a-methyl-3-propan-2-yl-2,3,3a,6,7,8-hexahydro-1H-azulen-5-yl)methyl-methylidyneazanium |
| SMILES | C#[N+]CC1=CC2C(C(C)C)CCC2(C)CCC1 |
| InChI | InChI=1S/C16H26N/c1-12(2)14-7-9-16(3)8-5-6-13(11-17-4)10-15(14)16/h4,10,12,14-15H,5-9,11H2,1-3H3/q+1 |
| InChIKey | DCGLALADDISMLY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|