C20H32 — CID 163097985
(1R,1aR,4aS,6R,7aR,7bS)-1-cyclohexyl-1,6-dimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene (PubChem CID 163097985) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1R,1aR,4aS,6R,7aR,7bS)-1-cyclohexyl-1,6-dimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene.
| Compound Name | (1R,1aR,4aS,6R,7aR,7bS)-1-cyclohexyl-1,6-dimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene |
|---|---|
| PubChem CID | 163097985 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1R,1aR,4aS,6R,7aR,7bS)-1-cyclohexyl-1,6-dimethyl-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulene |
| SMILES | C=C1CC[C@@H]2[C@H]([C@@H]3C[C@@H](C)C[C@H]13)[C@]2(C)C1CCCCC1 |
| InChI | InChI=1S/C20H32/c1-13-11-16-14(2)9-10-18-19(17(16)12-13)20(18,3)15-7-5-4-6-8-15/h13,15-19H,2,4-12H2,1,3H3/t13-,16+,17+,18+,19-,20+/m0/s1 |
| InChIKey | CCAOEVWDWKOAIX-QNYNDTLLSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|