C10H18O7 — CID 163098006
(2S,3S,4R,5R,6S)-2-(2-hydroxybut-3-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163098006) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-(2-hydroxybut-3-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-(2-hydroxybut-3-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163098006 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-(2-hydroxybut-3-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=CC(O)CO[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H18O7/c1-2-5(12)4-16-10-9(15)8(14)7(13)6(3-11)17-10/h2,5-15H,1,3-4H2/t5?,6-,7-,8+,9-,10-/m0/s1 |
| InChIKey | JIMWXFWXOSWLSG-HSDFISHXSA-N |
| XLogP | -2.65 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|