C22H33NO5 — CID 163098102
(1S,2R,3S,3'S,4S,6R,11S)-3-ethyl-3'-methyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]spiro[5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,5'-oxolane]-2'-one (PubChem CID 163098102) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is (1S,2R,3S,3'S,4S,6R,11S)-3-ethyl-3'-methyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]spiro[5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,5'-oxolane]-2'-one.
| Compound Name | (1S,2R,3S,3'S,4S,6R,11S)-3-ethyl-3'-methyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]spiro[5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 163098102 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (1S,2R,3S,3'S,4S,6R,11S)-3-ethyl-3'-methyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]spiro[5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,5'-oxolane]-2'-one |
| SMILES | CC[C@H]1[C@H]2[C@@H](CCCN3[C@H]2CC[C@H]3[C@@H]2C[C@H](C)C(=O)O2)O[C@]12C[C@H](C)C(=O)O2 |
| InChI | InChI=1S/C22H33NO5/c1-4-14-19-16-8-7-15(18-10-12(2)20(24)26-18)23(16)9-5-6-17(19)27-22(14)11-13(3)21(25)28-22/h12-19H,4-11H2,1-3H3/t12-,13-,14-,15-,16-,17+,18-,19+,22-/m0/s1 |
| InChIKey | LJJHXRHHLDKWHD-JNWFCKCLSA-N |
| XLogP | 2.89 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |