C22H34O7 — CID 163098115
(3S,3aR,6E,9S,10E,11aS)-3,6,10-trimethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,3a,4,5,8,9,11a-octahydrocyclopenta[10]annulen-2-one (PubChem CID 163098115) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is (3S,3aR,6E,9S,10E,11aS)-3,6,10-trimethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,3a,4,5,8,9,11a-octahydrocyclopenta[10]annulen-2-one.
| Compound Name | (3S,3aR,6E,9S,10E,11aS)-3,6,10-trimethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,3a,4,5,8,9,11a-octahydrocyclopenta[10]annulen-2-one |
|---|---|
| PubChem CID | 163098115 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (3S,3aR,6E,9S,10E,11aS)-3,6,10-trimethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,3a,4,5,8,9,11a-octahydrocyclopenta[10]annulen-2-one |
| SMILES | C/C1=C\C[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)/C(C)=C/[C@H]2CC(=O)[C@@H](C)[C@@H]2CC1 |
| InChI | InChI=1S/C22H34O7/c1-11-4-6-15-13(3)16(24)9-14(15)8-12(2)17(7-5-11)28-22-21(27)20(26)19(25)18(10-23)29-22/h5,8,13-15,17-23,25-27H,4,6-7,9-10H2,1-3H3/b11-5+,12-8+/t13-,14-,15-,17-,18+,19+,20-,21+,22+/m0/s1 |
| InChIKey | PIGWEWIMWORLSM-NYGLTVQJSA-N |
| XLogP | 1.09 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|