C17H23BrO3 — CID 163098546
[(Z,1S)-1-[(2S,7R)-7-[(1S)-1-bromopropyl]-2,3,6,7-tetrahydrooxepin-2-yl]hex-3-en-5-ynyl] acetate (PubChem CID 163098546) has the molecular formula C17H23BrO3 and a molecular weight of 355.27 g/mol. Its IUPAC name is [(Z,1S)-1-[(2S,7R)-7-[(1S)-1-bromopropyl]-2,3,6,7-tetrahydrooxepin-2-yl]hex-3-en-5-ynyl] acetate.
| Compound Name | [(Z,1S)-1-[(2S,7R)-7-[(1S)-1-bromopropyl]-2,3,6,7-tetrahydrooxepin-2-yl]hex-3-en-5-ynyl] acetate |
|---|---|
| PubChem CID | 163098546 |
| Molecular Formula | C17H23BrO3 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [(Z,1S)-1-[(2S,7R)-7-[(1S)-1-bromopropyl]-2,3,6,7-tetrahydrooxepin-2-yl]hex-3-en-5-ynyl] acetate |
| SMILES | C#C/C=C\C[C@H](OC(C)=O)[C@@H]1CC=CC[C@H]([C@@H](Br)CC)O1 |
| InChI | InChI=1S/C17H23BrO3/c1-4-6-7-11-16(20-13(3)19)17-12-9-8-10-15(21-17)14(18)5-2/h1,6-9,14-17H,5,10-12H2,2-3H3/b7-6-/t14-,15+,16-,17-/m0/s1 |
| InChIKey | OELZRAJPVXSYFO-PPLLAWBQSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|