C38H58O10 — CID 163099075
6-[[8a-carboxy-4,4,6a,11,11,14b-hexamethyl-6b-(3-oxopropyl)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163099075) has the molecular formula C38H58O10 and a molecular weight of 674.87 g/mol. Its IUPAC name is 6-[[8a-carboxy-4,4,6a,11,11,14b-hexamethyl-6b-(3-oxopropyl)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[[8a-carboxy-4,4,6a,11,11,14b-hexamethyl-6b-(3-oxopropyl)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163099075 |
| Molecular Formula | C38H58O10 |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.40 |
| IUPAC Name | 6-[[8a-carboxy-4,4,6a,11,11,14b-hexamethyl-6b-(3-oxopropyl)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(CCC=O)C(=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(O)C6O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C38H58O10/c1-33(2)15-16-37(32(45)46)17-18-38(12-7-19-39)21(22(37)20-33)8-9-24-35(5)13-11-25(34(3,4)23(35)10-14-36(24,38)6)47-31-28(42)26(40)27(41)29(48-31)30(43)44/h8,19,22-29,31,40-42H,7,9-18,20H2,1-6H3,(H,43,44)(H,45,46) |
| InChIKey | DZKOXINVJCTGFJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|