C61H72N4O7 — CID 163099499
CID 163099499 (PubChem CID 163099499) has the molecular formula C61H72N4O7 and a molecular weight of 973.27 g/mol.
| Compound Name | CID 163099499 |
|---|---|
| PubChem CID | 163099499 |
| Molecular Formula | C61H72N4O7 |
| Molecular Weight | 973.27 g/mol |
| Exact Mass | 972.54 |
| IUPAC Name | — |
| SMILES | N[C@@H]1NC[C@H]2c3c1ccc1c3[C@H](c3c[nH]c4cn(cc34)[C@H]3Oc4cc(CCC(=O)C[C@H](O)[C@H]5C=C[C@@H](C6CCCCC6)C[C@H]5O)c(O)cc4OC#CC4(CCCC4)[C@@H]3C#C[C@@H]1O)C1(CCCC1)C21CCCC1 |
| InChI | InChI=1S/C61H72N4O7/c62-57-42-17-16-41-48(67)19-18-45-58(65-34-44-43(32-63-47(44)35-65)56-55(41)54(42)46(33-64-57)60(22-6-7-23-60)61(56)24-8-9-25-61)72-53-29-38(49(68)31-52(53)71-27-26-59(45)20-4-5-21-59)12-14-39(66)30-51(70)40-15-13-37(28-50(40)69)36-10-2-1-3-11-36/h13,15-17,29,31-32,34-37,40,45-46,48,50-51,56-58,63-64,67-70H,1-12,14,20-25,28,30,33,62H2/t37-,40+,45-,46+,48+,50-,51+,56+,57-,58+/m1/s1 |
| InChIKey | IOXKDADISWCEMU-OLGJPIEDSA-N |
| XLogP | 10.13 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.27 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|