C21H32O6 — CID 163099579
[(2E,6E,8S,10E)-8,12-diacetyloxy-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate (PubChem CID 163099579) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(2E,6E,8S,10E)-8,12-diacetyloxy-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate.
| Compound Name | [(2E,6E,8S,10E)-8,12-diacetyloxy-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 163099579 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(2E,6E,8S,10E)-8,12-diacetyloxy-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)[C@H](C/C=C(\C)COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C21H32O6/c1-15(12-13-25-18(4)22)8-7-9-17(3)21(27-20(6)24)11-10-16(2)14-26-19(5)23/h9-10,12,21H,7-8,11,13-14H2,1-6H3/b15-12+,16-10+,17-9+/t21-/m0/s1 |
| InChIKey | CONZVMGKHGPFDE-PCFNEIJGSA-N |
| XLogP | 4.05 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|