C40H56O3 — CID 163100564
(8E,10E,12E,14E,16E,18E,20E,22E,24E)-25-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-6,6,10,14,19,23-hexamethylpentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione (PubChem CID 163100564) has the molecular formula C40H56O3 and a molecular weight of 584.89 g/mol. Its IUPAC name is (8E,10E,12E,14E,16E,18E,20E,22E,24E)-25-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-6,6,10,14,19,23-hexamethylpentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione.
| Compound Name | (8E,10E,12E,14E,16E,18E,20E,22E,24E)-25-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-6,6,10,14,19,23-hexamethylpentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione |
|---|---|
| PubChem CID | 163100564 |
| Molecular Formula | C40H56O3 |
| Molecular Weight | 584.89 g/mol |
| Exact Mass | 584.42 |
| IUPAC Name | (8E,10E,12E,14E,16E,18E,20E,22E,24E)-25-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-6,6,10,14,19,23-hexamethylpentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione |
| SMILES | CC(=O)CCCC(C)(C)C(=O)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@H](O)CC1(C)C |
| InChI | InChI=1S/C40H56O3/c1-30(18-13-20-32(3)23-25-37-34(5)28-36(42)29-40(37,9)10)16-11-12-17-31(2)19-14-21-33(4)24-26-38(43)39(7,8)27-15-22-35(6)41/h11-14,16-21,23-26,36,42H,15,22,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+/t36-/m0/s1 |
| InChIKey | DSSJLYAIYPLGLX-GMKWGACXSA-N |
| XLogP | 10.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.89 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|