C35H47NOS2 — CID 163100984
10-(1,5-dimethylcyclohex-2-en-1-yl)-17-methyl-14,15-dithia-18-azapentacyclo[17.6.2.12,6.18,12.020,25]nonacosa-2,4,6(29),20,22,24-hexaen-4-ol (PubChem CID 163100984) has the molecular formula C35H47NOS2 and a molecular weight of 561.90 g/mol. Its IUPAC name is 10-(1,5-dimethylcyclohex-2-en-1-yl)-17-methyl-14,15-dithia-18-azapentacyclo[17.6.2.12,6.18,12.020,25]nonacosa-2,4,6(29),20,22,24-hexaen-4-ol.
| Compound Name | 10-(1,5-dimethylcyclohex-2-en-1-yl)-17-methyl-14,15-dithia-18-azapentacyclo[17.6.2.12,6.18,12.020,25]nonacosa-2,4,6(29),20,22,24-hexaen-4-ol |
|---|---|
| PubChem CID | 163100984 |
| Molecular Formula | C35H47NOS2 |
| Molecular Weight | 561.90 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 10-(1,5-dimethylcyclohex-2-en-1-yl)-17-methyl-14,15-dithia-18-azapentacyclo[17.6.2.12,6.18,12.020,25]nonacosa-2,4,6(29),20,22,24-hexaen-4-ol |
| SMILES | CC1CC=CC(C)(C2CC3CSSCC(C)NC4CCC(c5cc(O)cc(c5)CC(C3)C2)c2ccccc24)C1 |
| InChI | InChI=1S/C35H47NOS2/c1-23-7-6-12-35(3,20-23)29-16-25-13-26-15-28(19-30(37)18-26)31-10-11-34(33-9-5-4-8-32(31)33)36-24(2)21-38-39-22-27(14-25)17-29/h4-6,8-9,12,15,18-19,23-25,27,29,31,34,36-37H,7,10-11,13-14,16-17,20-22H2,1-3H3 |
| InChIKey | USBLETYKXZAUDL-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.90 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|