C25H36O5 — CID 163101541
(3Z,5E,8R,9E,11Z,14S,16R,17E,19E,24S)-24-ethyl-8,14,16-trihydroxy-1-oxacyclotetracosa-3,5,9,11,17,19-hexaen-2-one (PubChem CID 163101541) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (3Z,5E,8R,9E,11Z,14S,16R,17E,19E,24S)-24-ethyl-8,14,16-trihydroxy-1-oxacyclotetracosa-3,5,9,11,17,19-hexaen-2-one.
| Compound Name | (3Z,5E,8R,9E,11Z,14S,16R,17E,19E,24S)-24-ethyl-8,14,16-trihydroxy-1-oxacyclotetracosa-3,5,9,11,17,19-hexaen-2-one |
|---|---|
| PubChem CID | 163101541 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (3Z,5E,8R,9E,11Z,14S,16R,17E,19E,24S)-24-ethyl-8,14,16-trihydroxy-1-oxacyclotetracosa-3,5,9,11,17,19-hexaen-2-one |
| SMILES | CC[C@H]1CCC/C=C/C=C/[C@H](O)C[C@@H](O)C/C=C\C=C\[C@H](O)C/C=C/C=C\C(=O)O1 |
| InChI | InChI=1S/C25H36O5/c1-2-24-18-12-5-3-4-8-16-22(27)20-23(28)17-11-6-9-14-21(26)15-10-7-13-19-25(29)30-24/h3-4,6-11,13-14,16,19,21-24,26-28H,2,5,12,15,17-18,20H2,1H3/b4-3+,10-7+,11-6-,14-9+,16-8+,19-13-/t21-,22-,23-,24-/m0/s1 |
| InChIKey | PNIHJNURJFVDOY-PULZRIITSA-N |
| XLogP | 4.08 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |