C29H46O7 — CID 163102284
2,3,14-trihydroxy-10,13-dimethyl-17-(2,3,7-trihydroxy-5-propan-2-ylhept-5-en-2-yl)-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 163102284) has the molecular formula C29H46O7 and a molecular weight of 506.68 g/mol. Its IUPAC name is 2,3,14-trihydroxy-10,13-dimethyl-17-(2,3,7-trihydroxy-5-propan-2-ylhept-5-en-2-yl)-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | 2,3,14-trihydroxy-10,13-dimethyl-17-(2,3,7-trihydroxy-5-propan-2-ylhept-5-en-2-yl)-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 163102284 |
| Molecular Formula | C29H46O7 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | 2,3,14-trihydroxy-10,13-dimethyl-17-(2,3,7-trihydroxy-5-propan-2-ylhept-5-en-2-yl)-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)C(=CCO)CC(O)C(C)(O)C1CCC2(O)C3=CC(=O)C4CC(O)C(O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C29H46O7/c1-16(2)17(8-11-30)12-25(34)28(5,35)24-7-10-29(36)19-13-21(31)20-14-22(32)23(33)15-26(20,3)18(19)6-9-27(24,29)4/h8,13,16,18,20,22-25,30,32-36H,6-7,9-12,14-15H2,1-5H3 |
| InChIKey | JHBBUAIBYMEEGM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|