C42H62O14 — CID 163102661
[9-acetyloxy-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yl-8-[3,4,5-triacetyloxy-6-(2-methylbut-3-en-2-yloxymethyl)oxan-2-yl]oxy-4-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl] acetate (PubChem CID 163102661) has the molecular formula C42H62O14 and a molecular weight of 790.94 g/mol. Its IUPAC name is [9-acetyloxy-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yl-8-[3,4,5-triacetyloxy-6-(2-methylbut-3-en-2-yloxymethyl)oxan-2-yl]oxy-4-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl] acetate.
| Compound Name | [9-acetyloxy-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yl-8-[3,4,5-triacetyloxy-6-(2-methylbut-3-en-2-yloxymethyl)oxan-2-yl]oxy-4-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl] acetate |
|---|---|
| PubChem CID | 163102661 |
| Molecular Formula | C42H62O14 |
| Molecular Weight | 790.94 g/mol |
| Exact Mass | 790.41 |
| IUPAC Name | [9-acetyloxy-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yl-8-[3,4,5-triacetyloxy-6-(2-methylbut-3-en-2-yloxymethyl)oxan-2-yl]oxy-4-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl] acetate |
| SMILES | C=CC(C)(C)OCC1OC(OC2C3=C(C(C)C)CC(OC(C)=O)C3(C)C=C3C(COC)CCC3C(C)C2OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C42H62O14/c1-14-41(10,11)49-20-32-36(52-25(7)45)38(53-26(8)46)39(54-27(9)47)40(55-32)56-37-34-30(21(2)3)17-33(50-23(5)43)42(34,12)18-31-28(19-48-13)15-16-29(31)22(4)35(37)51-24(6)44/h14,18,21-22,28-29,32-33,35-40H,1,15-17,19-20H2,2-13H3 |
| InChIKey | CXKBWSKCWUZSCA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|