C24H35NO7 — CID 163103626
4,6,19-trimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docos-14-en-3-ol (PubChem CID 163103626) has the molecular formula C24H35NO7 and a molecular weight of 449.54 g/mol. Its IUPAC name is 4,6,19-trimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docos-14-en-3-ol.
| Compound Name | 4,6,19-trimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docos-14-en-3-ol |
|---|---|
| PubChem CID | 163103626 |
| Molecular Formula | C24H35NO7 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 4,6,19-trimethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docos-14-en-3-ol |
| SMILES | COCC12C=NC3C4(C(OC)CC1)C2CC31OCOC12CC(OC)C1CC4C2(O)C1OC |
| InChI | InChI=1S/C24H35NO7/c1-27-11-20-6-5-17(29-3)23-15-7-13-14(28-2)8-22(24(15,26)18(13)30-4)21(9-16(20)23,31-12-32-22)19(23)25-10-20/h10,13-19,26H,5-9,11-12H2,1-4H3 |
| InChIKey | CADWDUBJVBYWFP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |