C20H24O6 — CID 163103660
[(1S,2R,5S,6R,7S,12R,14R)-5,9,14-trimethyl-4,11-dioxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl] 3-methylbut-2-enoate (PubChem CID 163103660) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is [(1S,2R,5S,6R,7S,12R,14R)-5,9,14-trimethyl-4,11-dioxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl] 3-methylbut-2-enoate.
| Compound Name | [(1S,2R,5S,6R,7S,12R,14R)-5,9,14-trimethyl-4,11-dioxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 163103660 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [(1S,2R,5S,6R,7S,12R,14R)-5,9,14-trimethyl-4,11-dioxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@H]1CC(C)=C2C(=O)[C@@H]3O[C@]3(C)[C@@H]2[C@@H]2OC(=O)[C@@H](C)[C@@H]21 |
| InChI | InChI=1S/C20H24O6/c1-8(2)6-12(21)24-11-7-9(3)13-15(20(5)18(26-20)16(13)22)17-14(11)10(4)19(23)25-17/h6,10-11,14-15,17-18H,7H2,1-5H3/t10-,11-,14+,15-,17+,18-,20+/m0/s1 |
| InChIKey | CFORTZTWTXKWFR-HUNROJQKSA-N |
| XLogP | 2.12 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|