C25H40NO9P — CID 163103690
[(1E,3R,4R,6R,7Z,9Z)-3-(2-aminoethyl)-1-[(2S,3S)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-3,6-dihydroxy-10-[(3S)-3-hydroxycyclohexyl]deca-1,7,9-trien-4-yl] dihydrogen phosphate (PubChem CID 163103690) has the molecular formula C25H40NO9P and a molecular weight of 529.57 g/mol. Its IUPAC name is [(1E,3R,4R,6R,7Z,9Z)-3-(2-aminoethyl)-1-[(2S,3S)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-3,6-dihydroxy-10-[(3S)-3-hydroxycyclohexyl]deca-1,7,9-trien-4-yl] dihydrogen phosphate.
| Compound Name | [(1E,3R,4R,6R,7Z,9Z)-3-(2-aminoethyl)-1-[(2S,3S)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-3,6-dihydroxy-10-[(3S)-3-hydroxycyclohexyl]deca-1,7,9-trien-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 163103690 |
| Molecular Formula | C25H40NO9P |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | [(1E,3R,4R,6R,7Z,9Z)-3-(2-aminoethyl)-1-[(2S,3S)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-3,6-dihydroxy-10-[(3S)-3-hydroxycyclohexyl]deca-1,7,9-trien-4-yl] dihydrogen phosphate |
| SMILES | CC[C@H]1C=CC(=O)O[C@H]1/C=C/[C@](O)(CCN)[C@@H](C[C@@H](O)/C=C\C=C/C1CCC[C@H](O)C1)OP(=O)(O)O |
| InChI | InChI=1S/C25H40NO9P/c1-2-19-10-11-24(29)34-22(19)12-13-25(30,14-15-26)23(35-36(31,32)33)17-21(28)8-4-3-6-18-7-5-9-20(27)16-18/h3-4,6,8,10-13,18-23,27-28,30H,2,5,7,9,14-17,26H2,1H3,(H2,31,32,33)/b6-3-,8-4-,13-12+/t18?,19-,20-,21-,22-,23+,25-/m0/s1 |
| InChIKey | CNIIGWQCMRZTQE-SZUZDQGSSA-N |
| XLogP | 2.02 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|