C21H26O10 — CID 163104083
(1S,5R,7R,10R)-2-methyl-11-methylidene-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-6,13-dioxatetracyclo[8.3.1.01,5.05,7]tetradec-2-ene-4,12-dione (PubChem CID 163104083) has the molecular formula C21H26O10 and a molecular weight of 438.43 g/mol. Its IUPAC name is (1S,5R,7R,10R)-2-methyl-11-methylidene-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-6,13-dioxatetracyclo[8.3.1.01,5.05,7]tetradec-2-ene-4,12-dione.
| Compound Name | (1S,5R,7R,10R)-2-methyl-11-methylidene-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-6,13-dioxatetracyclo[8.3.1.01,5.05,7]tetradec-2-ene-4,12-dione |
|---|---|
| PubChem CID | 163104083 |
| Molecular Formula | C21H26O10 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (1S,5R,7R,10R)-2-methyl-11-methylidene-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-6,13-dioxatetracyclo[8.3.1.01,5.05,7]tetradec-2-ene-4,12-dione |
| SMILES | C=C1C(=O)O[C@]23C[C@H]1CC[C@]1(CO[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)O[C@@]12C(=O)C=C3C |
| InChI | InChI=1S/C21H26O10/c1-9-5-13(23)21-19(31-21,4-3-11-6-20(9,21)30-17(27)10(11)2)8-28-18-16(26)15(25)14(24)12(7-22)29-18/h5,11-12,14-16,18,22,24-26H,2-4,6-8H2,1H3/t11-,12-,14-,15+,16-,18-,19-,20+,21+/m1/s1 |
| InChIKey | GBOALAPFIIYRMB-JUPGDIBASA-N |
| XLogP | -1.51 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|